C19H23N3O4 — CID 67354653
ethyl 3-[4-(cyclohexylcarbamoylamino)phenyl]-1,2-oxazole-5-carboxylate (PubChem CID 67354653) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is ethyl 3-[4-(cyclohexylcarbamoylamino)phenyl]-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 3-[4-(cyclohexylcarbamoylamino)phenyl]-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 67354653 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | ethyl 3-[4-(cyclohexylcarbamoylamino)phenyl]-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(NC(=O)NC3CCCCC3)cc2)no1 |
| InChI | InChI=1S/C19H23N3O4/c1-2-25-18(23)17-12-16(22-26-17)13-8-10-15(11-9-13)21-19(24)20-14-6-4-3-5-7-14/h8-12,14H,2-7H2,1H3,(H2,20,21,24) |
| InChIKey | NKSLPHLKTWJCCH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |