C13H10F3NO4 — CID 139453528
ethyl 3-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-5-carboxylate (PubChem CID 139453528) has the molecular formula C13H10F3NO4 and a molecular weight of 301.22 g/mol. Its IUPAC name is ethyl 3-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 3-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 139453528 |
| Molecular Formula | C13H10F3NO4 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | ethyl 3-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(OC(F)(F)F)cc2)no1 |
| InChI | InChI=1S/C13H10F3NO4/c1-2-19-12(18)11-7-10(17-21-11)8-3-5-9(6-4-8)20-13(14,15)16/h3-7H,2H2,1H3 |
| InChIKey | SKTNXZQOBYXELF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |