C16H13F3N2O3 — CID 144580562
(2Z,4E)-5-(methylamino)-4-[3-[4-(trifluoromethoxy)phenyl]-1,2-oxazol-5-yl]penta-2,4-dienal (PubChem CID 144580562) has the molecular formula C16H13F3N2O3 and a molecular weight of 338.29 g/mol. Its IUPAC name is (2Z,4E)-5-(methylamino)-4-[3-[4-(trifluoromethoxy)phenyl]-1,2-oxazol-5-yl]penta-2,4-dienal.
| Compound Name | (2Z,4E)-5-(methylamino)-4-[3-[4-(trifluoromethoxy)phenyl]-1,2-oxazol-5-yl]penta-2,4-dienal |
|---|---|
| PubChem CID | 144580562 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (2Z,4E)-5-(methylamino)-4-[3-[4-(trifluoromethoxy)phenyl]-1,2-oxazol-5-yl]penta-2,4-dienal |
| SMILES | CN/C=C(\C=C/C=O)c1cc(-c2ccc(OC(F)(F)F)cc2)no1 |
| InChI | InChI=1S/C16H13F3N2O3/c1-20-10-12(3-2-8-22)15-9-14(21-24-15)11-4-6-13(7-5-11)23-16(17,18)19/h2-10,20H,1H3/b3-2-,12-10+ |
| InChIKey | YGLGAKSRWQCLGZ-QTXYNGLRSA-N |
| XLogP | 3.56 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|