C13H12N2O5 — CID 67352122
ethyl 3-(3-methyl-4-nitrophenyl)-1,2-oxazole-5-carboxylate (PubChem CID 67352122) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is ethyl 3-(3-methyl-4-nitrophenyl)-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl 3-(3-methyl-4-nitrophenyl)-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 67352122 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | ethyl 3-(3-methyl-4-nitrophenyl)-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc([N+](=O)[O-])c(C)c2)no1 |
| InChI | InChI=1S/C13H12N2O5/c1-3-19-13(16)12-7-10(14-20-12)9-4-5-11(15(17)18)8(2)6-9/h4-7H,3H2,1-2H3 |
| InChIKey | LZUUEGRGYAETNY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|