C16H17ClN2O2 — CID 17252724
5-(4-chlorophenyl)-N-cyclohexyl-1,2-oxazole-3-carboxamide (PubChem CID 17252724) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-cyclohexyl-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-cyclohexyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 17252724 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 5-(4-chlorophenyl)-N-cyclohexyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C16H17ClN2O2/c17-12-8-6-11(7-9-12)15-10-14(19-21-15)16(20)18-13-4-2-1-3-5-13/h6-10,13H,1-5H2,(H,18,20) |
| InChIKey | OAXQVBQSICONLJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |