C16H11ClN2O5S — CID 112503122
N-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 112503122) has the molecular formula C16H11ClN2O5S and a molecular weight of 378.79 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 112503122 |
| Molecular Formula | C16H11ClN2O5S |
| Molecular Weight | 378.79 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | N-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccc(Cl)cc2)no1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H11ClN2O5S/c17-11-3-1-10(2-4-11)13-8-16(24-18-13)19-25(20,21)12-5-6-14-15(7-12)23-9-22-14/h1-8,19H,9H2 |
| InChIKey | IKNLGHIBAVHZLH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.79 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |