C34H26Br2N4O10S2 — CID 162219744
4-(1,3-benzodioxol-5-yl)-N-(4-bromo-3-methyl-1,2-oxazol-5-yl)benzenesulfonamide (PubChem CID 162219744) has the molecular formula C34H26Br2N4O10S2 and a molecular weight of 874.54 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-(4-bromo-3-methyl-1,2-oxazol-5-yl)benzenesulfonamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-(4-bromo-3-methyl-1,2-oxazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 162219744 |
| Molecular Formula | C34H26Br2N4O10S2 |
| Molecular Weight | 874.54 g/mol |
| Exact Mass | 871.95 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-(4-bromo-3-methyl-1,2-oxazol-5-yl)benzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(-c3ccc4c(c3)OCO4)cc2)c1Br.Cc1noc(NS(=O)(=O)c2ccc(-c3ccc4c(c3)OCO4)cc2)c1Br |
| InChI | InChI=1S/2C17H13BrN2O5S/c2*1-10-16(18)17(25-19-10)20-26(21,22)13-5-2-11(3-6-13)12-4-7-14-15(8-12)24-9-23-14/h2*2-8,20H,9H2,1H3 |
| InChIKey | ZTYNPOONDZGZIE-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 181.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.54 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |