C10H8BrClN2O3S — CID 18617374
N-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-chlorobenzenesulfonamide (PubChem CID 18617374) has the molecular formula C10H8BrClN2O3S and a molecular weight of 351.61 g/mol. Its IUPAC name is N-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-chlorobenzenesulfonamide.
| Compound Name | N-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 18617374 |
| Molecular Formula | C10H8BrClN2O3S |
| Molecular Weight | 351.61 g/mol |
| Exact Mass | 349.91 |
| IUPAC Name | N-(4-bromo-3-methyl-1,2-oxazol-5-yl)-3-chlorobenzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2cccc(Cl)c2)c1Br |
| InChI | InChI=1S/C10H8BrClN2O3S/c1-6-9(11)10(17-13-6)14-18(15,16)8-4-2-3-7(12)5-8/h2-5,14H,1H3 |
| InChIKey | KZMQHIBFSGTCHI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |