C10H6BrCl3N2O3S — CID 18617286
N-(4-bromo-3-methyl-1,2-oxazol-5-yl)-2,4,5-trichlorobenzenesulfonamide (PubChem CID 18617286) has the molecular formula C10H6BrCl3N2O3S and a molecular weight of 420.50 g/mol. Its IUPAC name is N-(4-bromo-3-methyl-1,2-oxazol-5-yl)-2,4,5-trichlorobenzenesulfonamide.
| Compound Name | N-(4-bromo-3-methyl-1,2-oxazol-5-yl)-2,4,5-trichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 18617286 |
| Molecular Formula | C10H6BrCl3N2O3S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 417.83 |
| IUPAC Name | N-(4-bromo-3-methyl-1,2-oxazol-5-yl)-2,4,5-trichlorobenzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)c1Br |
| InChI | InChI=1S/C10H6BrCl3N2O3S/c1-4-9(11)10(19-15-4)16-20(17,18)8-3-6(13)5(12)2-7(8)14/h2-3,16H,1H3 |
| InChIKey | YXKDNGMADBWIQP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|