C10H8BrN3O5S — CID 22411376
N-(4-bromo-3-methyl-1,2-oxazol-5-yl)-2-nitrobenzenesulfonamide (PubChem CID 22411376) has the molecular formula C10H8BrN3O5S and a molecular weight of 362.16 g/mol. Its IUPAC name is N-(4-bromo-3-methyl-1,2-oxazol-5-yl)-2-nitrobenzenesulfonamide.
| Compound Name | N-(4-bromo-3-methyl-1,2-oxazol-5-yl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 22411376 |
| Molecular Formula | C10H8BrN3O5S |
| Molecular Weight | 362.16 g/mol |
| Exact Mass | 360.94 |
| IUPAC Name | N-(4-bromo-3-methyl-1,2-oxazol-5-yl)-2-nitrobenzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccccc2[N+](=O)[O-])c1Br |
| InChI | InChI=1S/C10H8BrN3O5S/c1-6-9(11)10(19-12-6)13-20(17,18)8-5-3-2-4-7(8)14(15)16/h2-5,13H,1H3 |
| InChIKey | WLRUSUWIKCSPQG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.16 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|