C11H8Cl2N2O3S2 — CID 19089331
1-(3,4-dichlorophenyl)-3-thiophen-2-ylsulfonylurea (PubChem CID 19089331) has the molecular formula C11H8Cl2N2O3S2 and a molecular weight of 351.24 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-thiophen-2-ylsulfonylurea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-thiophen-2-ylsulfonylurea |
|---|---|
| PubChem CID | 19089331 |
| Molecular Formula | C11H8Cl2N2O3S2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 349.94 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-thiophen-2-ylsulfonylurea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C11H8Cl2N2O3S2/c12-8-4-3-7(6-9(8)13)14-11(16)15-20(17,18)10-2-1-5-19-10/h1-6H,(H2,14,15,16) |
| InChIKey | MTJLATQLQVUASU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |