C28H27ClN4OS — CID 134227618
2-[[6-(4-chlorophenyl)-5-(4-propan-2-yloxyphenyl)-3-pyridinyl]methyl]-1-phenylsulfanylguanidine (PubChem CID 134227618) has the molecular formula C28H27ClN4OS and a molecular weight of 503.07 g/mol. Its IUPAC name is 2-[[6-(4-chlorophenyl)-5-(4-propan-2-yloxyphenyl)-3-pyridinyl]methyl]-1-phenylsulfanylguanidine.
| Compound Name | 2-[[6-(4-chlorophenyl)-5-(4-propan-2-yloxyphenyl)-3-pyridinyl]methyl]-1-phenylsulfanylguanidine |
|---|---|
| PubChem CID | 134227618 |
| Molecular Formula | C28H27ClN4OS |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-[[6-(4-chlorophenyl)-5-(4-propan-2-yloxyphenyl)-3-pyridinyl]methyl]-1-phenylsulfanylguanidine |
| SMILES | CC(C)Oc1ccc(-c2cc(C/N=C(\N)NSc3ccccc3)cnc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H27ClN4OS/c1-19(2)34-24-14-10-21(11-15-24)26-16-20(17-31-27(26)22-8-12-23(29)13-9-22)18-32-28(30)33-35-25-6-4-3-5-7-25/h3-17,19H,18H2,1-2H3,(H3,30,32,33) |
| InChIKey | VARLOWJTYLURKT-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|