C28H26Cl2N4O3S — CID 134228076
tert-butyl N-[N'-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-N-(furan-3-ylsulfanyl)carbamimidoyl]carbamate (PubChem CID 134228076) has the molecular formula C28H26Cl2N4O3S and a molecular weight of 569.51 g/mol. Its IUPAC name is tert-butyl N-[N'-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-N-(furan-3-ylsulfanyl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-N-(furan-3-ylsulfanyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 134228076 |
| Molecular Formula | C28H26Cl2N4O3S |
| Molecular Weight | 569.51 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | tert-butyl N-[N'-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-N-(furan-3-ylsulfanyl)carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(=N/Cc1cnc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)c1)NSc1ccoc1 |
| InChI | InChI=1S/C28H26Cl2N4O3S/c1-28(2,3)37-27(35)33-26(34-38-23-12-13-36-17-23)32-16-18-14-24(19-4-8-21(29)9-5-19)25(31-15-18)20-6-10-22(30)11-7-20/h4-15,17H,16H2,1-3H3,(H2,32,33,34,35) |
| InChIKey | GUHBMECOIYUTEL-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.51 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|