C23H20Cl2N6S — CID 134228153
2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(1-methylpyrazol-4-yl)sulfanylguanidine (PubChem CID 134228153) has the molecular formula C23H20Cl2N6S and a molecular weight of 483.43 g/mol. Its IUPAC name is 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(1-methylpyrazol-4-yl)sulfanylguanidine.
| Compound Name | 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(1-methylpyrazol-4-yl)sulfanylguanidine |
|---|---|
| PubChem CID | 134228153 |
| Molecular Formula | C23H20Cl2N6S |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(1-methylpyrazol-4-yl)sulfanylguanidine |
| SMILES | Cn1cc(SN/C(N)=N/Cc2cnc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)c2)cn1 |
| InChI | InChI=1S/C23H20Cl2N6S/c1-31-14-20(13-29-31)32-30-23(26)28-12-15-10-21(16-2-6-18(24)7-3-16)22(27-11-15)17-4-8-19(25)9-5-17/h2-11,13-14H,12H2,1H3,(H3,26,28,30) |
| InChIKey | HZFMWHRIUQAXHC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|