C26H21F3N4O2S — CID 134227859
1-(benzenesulfonyl)-2-[[6-phenyl-5-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]guanidine (PubChem CID 134227859) has the molecular formula C26H21F3N4O2S and a molecular weight of 510.54 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-[[6-phenyl-5-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-(benzenesulfonyl)-2-[[6-phenyl-5-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 134227859 |
| Molecular Formula | C26H21F3N4O2S |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 1-(benzenesulfonyl)-2-[[6-phenyl-5-[4-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1cnc(-c2ccccc2)c(-c2ccc(C(F)(F)F)cc2)c1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H21F3N4O2S/c27-26(28,29)21-13-11-19(12-14-21)23-15-18(16-31-24(23)20-7-3-1-4-8-20)17-32-25(30)33-36(34,35)22-9-5-2-6-10-22/h1-16H,17H2,(H3,30,32,33) |
| InChIKey | LNAMXGAJKHAVGJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|