About (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate
(4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate (PubChem CID 87356365) has the molecular formula C11H13BrO4S
and a molecular weight of 321.19 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate.
Molecular Properties
| Compound Name | (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate |
| PubChem CID | 87356365 |
| Molecular Formula | C11H13BrO4S |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)OC(=O)C(C)(C)Br)cc1 |
| InChI | InChI=1S/C11H13BrO4S/c1-8-4-6-9(7-5-8)17(14,15)16-10(13)11(2,3)12/h4-7H,1-3H3 |
| InChIKey | DSLGKWHUGBTTJP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate?
The IUPAC name of (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate (CID 87356365) is (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate.
What is the SMILES notation for (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate?
The canonical SMILES for (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate is Cc1ccc(S(=O)(=O)OC(=O)C(C)(C)Br)cc1.
What is the InChIKey of (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate?
The InChIKey is DSLGKWHUGBTTJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO4S/c1-8-4-6-9(7-5-8)17(14,15)16-10(13)11(2,3)12/h4-7H,1-3H3.
What are the key properties of (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate?
(4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate has a molecular weight of 321.19 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)sulfonyl 2-bromo-2-methylpropanoate is sourced from PubChem (CID 87356365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).