C10H11KO6S — CID 23699072
potassium 2-hydroxy-2-(4-methylphenyl)sulfonyloxypropanoate (PubChem CID 23699072) has the molecular formula C10H11KO6S and a molecular weight of 298.36 g/mol. Its IUPAC name is potassium 2-hydroxy-2-(4-methylphenyl)sulfonyloxypropanoate.
| Compound Name | potassium 2-hydroxy-2-(4-methylphenyl)sulfonyloxypropanoate |
|---|---|
| PubChem CID | 23699072 |
| Molecular Formula | C10H11KO6S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | potassium 2-hydroxy-2-(4-methylphenyl)sulfonyloxypropanoate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)(O)C(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C10H12O6S.K/c1-7-3-5-8(6-4-7)17(14,15)16-10(2,13)9(11)12;/h3-6,13H,1-2H3,(H,11,12);/q;+1/p-1 |
| InChIKey | XECNAXHKUYRURC-UHFFFAOYSA-M |
| XLogP | -3.84 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|