C20H34O3S — CID 89415026
[2,6-dimethyl-4-(2-methylpropyl)heptan-4-yl] 4-methylbenzenesulfonate (PubChem CID 89415026) has the molecular formula C20H34O3S and a molecular weight of 354.56 g/mol. Its IUPAC name is [2,6-dimethyl-4-(2-methylpropyl)heptan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [2,6-dimethyl-4-(2-methylpropyl)heptan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89415026 |
| Molecular Formula | C20H34O3S |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [2,6-dimethyl-4-(2-methylpropyl)heptan-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(CC(C)C)(CC(C)C)CC(C)C)cc1 |
| InChI | InChI=1S/C20H34O3S/c1-15(2)12-20(13-16(3)4,14-17(5)6)23-24(21,22)19-10-8-18(7)9-11-19/h8-11,15-17H,12-14H2,1-7H3 |
| InChIKey | IVMIOCHIMDLUKV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|