C20H23NO4S — CID 87239916
(4-methylphenyl)sulfonyl (2S)-2-amino-2-cyclopentyl-2-phenylacetate (PubChem CID 87239916) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl (2S)-2-amino-2-cyclopentyl-2-phenylacetate.
| Compound Name | (4-methylphenyl)sulfonyl (2S)-2-amino-2-cyclopentyl-2-phenylacetate |
|---|---|
| PubChem CID | 87239916 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (4-methylphenyl)sulfonyl (2S)-2-amino-2-cyclopentyl-2-phenylacetate |
| SMILES | Cc1ccc(S(=O)(=O)OC(=O)[C@@](N)(c2ccccc2)C2CCCC2)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-15-11-13-18(14-12-15)26(23,24)25-19(22)20(21,17-9-5-6-10-17)16-7-3-2-4-8-16/h2-4,7-8,11-14,17H,5-6,9-10,21H2,1H3/t20-/m1/s1 |
| InChIKey | DYCWYCHSJZQZHW-HXUWFJFHSA-N |
| XLogP | 3.27 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|