C29H31NO6S — CID 25180547
phenyl 3-(cyclohexylamino)-2-[(4-methylphenyl)sulfonyloxymethyl]-3-oxo-2-phenylpropanoate (PubChem CID 25180547) has the molecular formula C29H31NO6S and a molecular weight of 521.64 g/mol. Its IUPAC name is phenyl 3-(cyclohexylamino)-2-[(4-methylphenyl)sulfonyloxymethyl]-3-oxo-2-phenylpropanoate.
| Compound Name | phenyl 3-(cyclohexylamino)-2-[(4-methylphenyl)sulfonyloxymethyl]-3-oxo-2-phenylpropanoate |
|---|---|
| PubChem CID | 25180547 |
| Molecular Formula | C29H31NO6S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | phenyl 3-(cyclohexylamino)-2-[(4-methylphenyl)sulfonyloxymethyl]-3-oxo-2-phenylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C(=O)NC2CCCCC2)(C(=O)Oc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H31NO6S/c1-22-17-19-26(20-18-22)37(33,34)35-21-29(23-11-5-2-6-12-23,27(31)30-24-13-7-3-8-14-24)28(32)36-25-15-9-4-10-16-25/h2,4-6,9-12,15-20,24H,3,7-8,13-14,21H2,1H3,(H,30,31) |
| InChIKey | UBDLDUKRZHVYTC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|