C22H28O3S — CID 22225867
(3-cyclohexyl-3-phenylpropyl) 4-methylbenzenesulfonate (PubChem CID 22225867) has the molecular formula C22H28O3S and a molecular weight of 372.53 g/mol. Its IUPAC name is (3-cyclohexyl-3-phenylpropyl) 4-methylbenzenesulfonate.
| Compound Name | (3-cyclohexyl-3-phenylpropyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22225867 |
| Molecular Formula | C22H28O3S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (3-cyclohexyl-3-phenylpropyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC(c2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H28O3S/c1-18-12-14-21(15-13-18)26(23,24)25-17-16-22(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2,4-5,8-9,12-15,20,22H,3,6-7,10-11,16-17H2,1H3 |
| InChIKey | QCCCFBDETFUOMK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|