C27H31NO3S — CID 58282566
[1-(3,3-diphenylpropyl)piperidin-4-yl] 4-methylbenzenesulfonate (PubChem CID 58282566) has the molecular formula C27H31NO3S and a molecular weight of 449.62 g/mol. Its IUPAC name is [1-(3,3-diphenylpropyl)piperidin-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-(3,3-diphenylpropyl)piperidin-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58282566 |
| Molecular Formula | C27H31NO3S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [1-(3,3-diphenylpropyl)piperidin-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCN(CCC(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H31NO3S/c1-22-12-14-26(15-13-22)32(29,30)31-25-16-19-28(20-17-25)21-18-27(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-15,25,27H,16-21H2,1H3 |
| InChIKey | YWGABPXONBEQDO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|