C26H30NO4S+ — CID 139914191
[1-ethyl-1-[(4-methoxyphenyl)-phenylmethyl]azetidin-1-ium-3-yl] 4-methylbenzenesulfonate (PubChem CID 139914191) has the molecular formula C26H30NO4S+ and a molecular weight of 452.60 g/mol. Its IUPAC name is [1-ethyl-1-[(4-methoxyphenyl)-phenylmethyl]azetidin-1-ium-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-ethyl-1-[(4-methoxyphenyl)-phenylmethyl]azetidin-1-ium-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139914191 |
| Molecular Formula | C26H30NO4S+ |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | [1-ethyl-1-[(4-methoxyphenyl)-phenylmethyl]azetidin-1-ium-3-yl] 4-methylbenzenesulfonate |
| SMILES | CC[N+]1(C(c2ccccc2)c2ccc(OC)cc2)CC(OS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C26H30NO4S/c1-4-27(18-24(19-27)31-32(28,29)25-16-10-20(2)11-17-25)26(21-8-6-5-7-9-21)22-12-14-23(30-3)15-13-22/h5-17,24,26H,4,18-19H2,1-3H3/q+1 |
| InChIKey | VTEMWBJCYUGKJJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|