C24H25ClNO3S+ — CID 139914164
[1-[(4-chlorophenyl)-phenylmethyl]-1-methylazetidin-1-ium-3-yl] 4-methylbenzenesulfonate (PubChem CID 139914164) has the molecular formula C24H25ClNO3S+ and a molecular weight of 442.99 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)-phenylmethyl]-1-methylazetidin-1-ium-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-[(4-chlorophenyl)-phenylmethyl]-1-methylazetidin-1-ium-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139914164 |
| Molecular Formula | C24H25ClNO3S+ |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | [1-[(4-chlorophenyl)-phenylmethyl]-1-methylazetidin-1-ium-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2C[N+](C)(C(c3ccccc3)c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C24H25ClNO3S/c1-18-8-14-23(15-9-18)30(27,28)29-22-16-26(2,17-22)24(19-6-4-3-5-7-19)20-10-12-21(25)13-11-20/h3-15,22,24H,16-17H2,1-2H3/q+1 |
| InChIKey | AGDCLQDRCCSACQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|