C21H28ClNO7S2 — CID 139914196
[1-[(4-chlorophenyl)-phenylmethyl]-1-ethylazetidin-1-ium-3-yl] methanesulfonate;ethyl sulfate (PubChem CID 139914196) has the molecular formula C21H28ClNO7S2 and a molecular weight of 506.04 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)-phenylmethyl]-1-ethylazetidin-1-ium-3-yl] methanesulfonate;ethyl sulfate.
| Compound Name | [1-[(4-chlorophenyl)-phenylmethyl]-1-ethylazetidin-1-ium-3-yl] methanesulfonate;ethyl sulfate |
|---|---|
| PubChem CID | 139914196 |
| Molecular Formula | C21H28ClNO7S2 |
| Molecular Weight | 506.04 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | [1-[(4-chlorophenyl)-phenylmethyl]-1-ethylazetidin-1-ium-3-yl] methanesulfonate;ethyl sulfate |
| SMILES | CCOS(=O)(=O)[O-].CC[N+]1(C(c2ccccc2)c2ccc(Cl)cc2)CC(OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C19H23ClNO3S.C2H6O4S/c1-3-21(13-18(14-21)24-25(2,22)23)19(15-7-5-4-6-8-15)16-9-11-17(20)12-10-16;1-2-6-7(3,4)5/h4-12,18-19H,3,13-14H2,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | QYFGOBCAEUWJTR-UHFFFAOYSA-M |
| XLogP | 3.11 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.04 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|