C13H19NO6S2 — CID 87252176
[(3S)-1-benzyl-5-methylsulfonyloxypyrrolidin-3-yl] methanesulfonate (PubChem CID 87252176) has the molecular formula C13H19NO6S2 and a molecular weight of 349.43 g/mol. Its IUPAC name is [(3S)-1-benzyl-5-methylsulfonyloxypyrrolidin-3-yl] methanesulfonate.
| Compound Name | [(3S)-1-benzyl-5-methylsulfonyloxypyrrolidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 87252176 |
| Molecular Formula | C13H19NO6S2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | [(3S)-1-benzyl-5-methylsulfonyloxypyrrolidin-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1C[C@H](OS(C)(=O)=O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C13H19NO6S2/c1-21(15,16)19-12-8-13(20-22(2,17)18)14(10-12)9-11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3/t12-,13?/m0/s1 |
| InChIKey | QZVYOLHLDZUJBV-UEWDXFNNSA-N |
| XLogP | 0.54 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|