C15H23N2OP — CID 166403005
(1S,4S)-2-benzyl-5-(dimethylphosphorylmethyl)-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 166403005) has the molecular formula C15H23N2OP and a molecular weight of 278.34 g/mol. Its IUPAC name is (1S,4S)-2-benzyl-5-(dimethylphosphorylmethyl)-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2-benzyl-5-(dimethylphosphorylmethyl)-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 166403005 |
| Molecular Formula | C15H23N2OP |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1S,4S)-2-benzyl-5-(dimethylphosphorylmethyl)-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CP(C)(=O)CN1C[C@@H]2C[C@H]1CN2Cc1ccccc1 |
| InChI | InChI=1S/C15H23N2OP/c1-19(2,18)12-17-11-14-8-15(17)10-16(14)9-13-6-4-3-5-7-13/h3-7,14-15H,8-12H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | LGUSUEJYPOSTRV-GJZGRUSLSA-N |
| XLogP | 2.53 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|