C12H17NS — CID 101363841
(2R)-1-benzyl-2-(ethylsulfanylmethyl)aziridine (PubChem CID 101363841) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is (2R)-1-benzyl-2-(ethylsulfanylmethyl)aziridine.
| Compound Name | (2R)-1-benzyl-2-(ethylsulfanylmethyl)aziridine |
|---|---|
| PubChem CID | 101363841 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (2R)-1-benzyl-2-(ethylsulfanylmethyl)aziridine |
| SMILES | CCSC[C@H]1CN1Cc1ccccc1 |
| InChI | InChI=1S/C12H17NS/c1-2-14-10-12-9-13(12)8-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3/t12-,13?/m1/s1 |
| InChIKey | WEBNETUEOYGOJZ-PZORYLMUSA-N |
| XLogP | 2.62 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|