C54H80N6 — CID 171735293
(2S,5S,8S)-1,4-dibenzyl-7-[2-[(2S,5S,8S)-4,7-dibenzyl-2,5,8-triethyl-1,4,7-triazonan-1-yl]ethyl]-2,5,8-triethyl-1,4,7-triazonane (PubChem CID 171735293) has the molecular formula C54H80N6 and a molecular weight of 813.28 g/mol. Its IUPAC name is (2S,5S,8S)-1,4-dibenzyl-7-[2-[(2S,5S,8S)-4,7-dibenzyl-2,5,8-triethyl-1,4,7-triazonan-1-yl]ethyl]-2,5,8-triethyl-1,4,7-triazonane.
| Compound Name | (2S,5S,8S)-1,4-dibenzyl-7-[2-[(2S,5S,8S)-4,7-dibenzyl-2,5,8-triethyl-1,4,7-triazonan-1-yl]ethyl]-2,5,8-triethyl-1,4,7-triazonane |
|---|---|
| PubChem CID | 171735293 |
| Molecular Formula | C54H80N6 |
| Molecular Weight | 813.28 g/mol |
| Exact Mass | 812.64 |
| IUPAC Name | (2S,5S,8S)-1,4-dibenzyl-7-[2-[(2S,5S,8S)-4,7-dibenzyl-2,5,8-triethyl-1,4,7-triazonan-1-yl]ethyl]-2,5,8-triethyl-1,4,7-triazonane |
| SMILES | CC[C@H]1CN(Cc2ccccc2)[C@@H](CC)CN(Cc2ccccc2)[C@@H](CC)CN1CCN1C[C@H](CC)N(Cc2ccccc2)C[C@H](CC)N(Cc2ccccc2)C[C@@H]1CC |
| InChI | InChI=1S/C54H80N6/c1-7-49-41-57(35-45-25-17-13-18-26-45)53(11-5)43-59(37-47-29-21-15-22-30-47)51(9-3)39-55(49)33-34-56-40-52(10-4)60(38-48-31-23-16-24-32-48)44-54(12-6)58(42-50(56)8-2)36-46-27-19-14-20-28-46/h13-32,49-54H,7-12,33-44H2,1-6H3/t49-,50-,51-,52-,53-,54-/m0/s1 |
| InChIKey | GQYSCADLWSDDQU-ZOPNQXNNSA-N |
| XLogP | 10.30 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.28 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |