C22H28N2O2S2 — CID 101363840
(2R)-1-[(4-methoxyphenyl)methyl]-2-[[[(2R)-1-[(4-methoxyphenyl)methyl]aziridin-2-yl]methyldisulfanyl]methyl]aziridine (PubChem CID 101363840) has the molecular formula C22H28N2O2S2 and a molecular weight of 416.61 g/mol. Its IUPAC name is (2R)-1-[(4-methoxyphenyl)methyl]-2-[[[(2R)-1-[(4-methoxyphenyl)methyl]aziridin-2-yl]methyldisulfanyl]methyl]aziridine.
| Compound Name | (2R)-1-[(4-methoxyphenyl)methyl]-2-[[[(2R)-1-[(4-methoxyphenyl)methyl]aziridin-2-yl]methyldisulfanyl]methyl]aziridine |
|---|---|
| PubChem CID | 101363840 |
| Molecular Formula | C22H28N2O2S2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (2R)-1-[(4-methoxyphenyl)methyl]-2-[[[(2R)-1-[(4-methoxyphenyl)methyl]aziridin-2-yl]methyldisulfanyl]methyl]aziridine |
| SMILES | COc1ccc(CN2C[C@@H]2CSSC[C@H]2CN2Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H28N2O2S2/c1-25-21-7-3-17(4-8-21)11-23-13-19(23)15-27-28-16-20-14-24(20)12-18-5-9-22(26-2)10-6-18/h3-10,19-20H,11-16H2,1-2H3/t19-,20-,23?,24?/m1/s1 |
| InChIKey | CRWTVDJAEQXEAW-LMHXZZLNSA-N |
| XLogP | 4.15 |
| TPSA | 24.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|