C17H26ClNO — CID 15503449
(2R,4R)-4-tert-butyl-2-(chloromethyl)-1-[(4-methoxyphenyl)methyl]pyrrolidine (PubChem CID 15503449) has the molecular formula C17H26ClNO and a molecular weight of 295.85 g/mol. Its IUPAC name is (2R,4R)-4-tert-butyl-2-(chloromethyl)-1-[(4-methoxyphenyl)methyl]pyrrolidine.
| Compound Name | (2R,4R)-4-tert-butyl-2-(chloromethyl)-1-[(4-methoxyphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 15503449 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (2R,4R)-4-tert-butyl-2-(chloromethyl)-1-[(4-methoxyphenyl)methyl]pyrrolidine |
| SMILES | COc1ccc(CN2C[C@@H](C(C)(C)C)C[C@@H]2CCl)cc1 |
| InChI | InChI=1S/C17H26ClNO/c1-17(2,3)14-9-15(10-18)19(12-14)11-13-5-7-16(20-4)8-6-13/h5-8,14-15H,9-12H2,1-4H3/t14-,15+/m0/s1 |
| InChIKey | IPPYYHKUEXWJHU-LSDHHAIUSA-N |
| XLogP | 4.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|