C19H29ClO — CID 63520591
1-[2-(4-tert-butylcyclohexyl)-2-chloroethyl]-4-methoxybenzene (PubChem CID 63520591) has the molecular formula C19H29ClO and a molecular weight of 308.89 g/mol. Its IUPAC name is 1-[2-(4-tert-butylcyclohexyl)-2-chloroethyl]-4-methoxybenzene.
| Compound Name | 1-[2-(4-tert-butylcyclohexyl)-2-chloroethyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 63520591 |
| Molecular Formula | C19H29ClO |
| Molecular Weight | 308.89 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1-[2-(4-tert-butylcyclohexyl)-2-chloroethyl]-4-methoxybenzene |
| SMILES | COc1ccc(CC(Cl)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H29ClO/c1-19(2,3)16-9-7-15(8-10-16)18(20)13-14-5-11-17(21-4)12-6-14/h5-6,11-12,15-16,18H,7-10,13H2,1-4H3 |
| InChIKey | FCNYBXIAIZHUGK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.89 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|