C14H18N2O2 — CID 130543589
2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid (PubChem CID 130543589) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid.
| Compound Name | 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid |
|---|---|
| PubChem CID | 130543589 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid |
| SMILES | O=C(O)CN1CC2CC1CN2Cc1ccccc1 |
| InChI | InChI=1S/C14H18N2O2/c17-14(18)10-16-9-12-6-13(16)8-15(12)7-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,17,18) |
| InChIKey | CKDLSGLUVKWCKO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |