2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid

C14H18N2O2 — CID 130543589

IUPAC2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid
SMILESO=C(O)CN1CC2CC1CN2Cc1ccccc1
InChIInChI=1S/C14H18N2O2/c17-14(18)10-16-9-12-6-13(16)8-15(12)7-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,17,18)
InChIKeyCKDLSGLUVKWCKO-UHFFFAOYSA-N
MW246.31 g/mol
LogP1.03
Rot. Bonds4

About 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid

2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid (PubChem CID 130543589) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid.

Molecular Properties

Compound Name2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid
PubChem CID130543589
Molecular FormulaC14H18N2O2
Molecular Weight246.31 g/mol
Exact Mass246.14
IUPAC Name2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid
SMILESO=C(O)CN1CC2CC1CN2Cc1ccccc1
InChIInChI=1S/C14H18N2O2/c17-14(18)10-16-9-12-6-13(16)8-15(12)7-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,17,18)
InChIKeyCKDLSGLUVKWCKO-UHFFFAOYSA-N
XLogP1.03
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.31
LogP ≤ 51.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid?
The IUPAC name of 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid (CID 130543589) is 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid.
What is the SMILES notation for 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid?
The canonical SMILES for 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid is O=C(O)CN1CC2CC1CN2Cc1ccccc1.
What is the InChIKey of 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid?
The InChIKey is CKDLSGLUVKWCKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c17-14(18)10-16-9-12-6-13(16)8-15(12)7-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,17,18).
What are the key properties of 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid?
2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid has a molecular weight of 246.31 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)acetic acid is sourced from PubChem (CID 130543589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).