C13H18FNO — CID 135010272
(2S,4R)-1-benzyl-2-(fluoromethyl)-4-methoxypyrrolidine (PubChem CID 135010272) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is (2S,4R)-1-benzyl-2-(fluoromethyl)-4-methoxypyrrolidine.
| Compound Name | (2S,4R)-1-benzyl-2-(fluoromethyl)-4-methoxypyrrolidine |
|---|---|
| PubChem CID | 135010272 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (2S,4R)-1-benzyl-2-(fluoromethyl)-4-methoxypyrrolidine |
| SMILES | CO[C@@H]1C[C@@H](CF)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C13H18FNO/c1-16-13-7-12(8-14)15(10-13)9-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3/t12-,13+/m0/s1 |
| InChIKey | VEWSSWNXCWDJHI-QWHCGFSZSA-N |
| XLogP | 2.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |