C19H23FN2 — CID 57436101
(2R)-1,4-dibenzyl-2-(fluoromethyl)piperazine (PubChem CID 57436101) has the molecular formula C19H23FN2 and a molecular weight of 298.41 g/mol. Its IUPAC name is (2R)-1,4-dibenzyl-2-(fluoromethyl)piperazine.
| Compound Name | (2R)-1,4-dibenzyl-2-(fluoromethyl)piperazine |
|---|---|
| PubChem CID | 57436101 |
| Molecular Formula | C19H23FN2 |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (2R)-1,4-dibenzyl-2-(fluoromethyl)piperazine |
| SMILES | FC[C@H]1CN(Cc2ccccc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C19H23FN2/c20-13-19-16-21(14-17-7-3-1-4-8-17)11-12-22(19)15-18-9-5-2-6-10-18/h1-10,19H,11-16H2/t19-/m0/s1 |
| InChIKey | SDEMZAXQOIWPPI-IBGZPJMESA-N |
| XLogP | 3.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |