C19H24N2O — CID 170598960
dideuterio-(1,4-dibenzylpiperazin-2-yl)methanol (PubChem CID 170598960) has the molecular formula C19H24N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is dideuterio-(1,4-dibenzylpiperazin-2-yl)methanol.
| Compound Name | dideuterio-(1,4-dibenzylpiperazin-2-yl)methanol |
|---|---|
| PubChem CID | 170598960 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | dideuterio-(1,4-dibenzylpiperazin-2-yl)methanol |
| SMILES | [2H]C([2H])(O)C1CN(Cc2ccccc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2O/c22-16-19-15-20(13-17-7-3-1-4-8-17)11-12-21(19)14-18-9-5-2-6-10-18/h1-10,19,22H,11-16H2/i16D2 |
| InChIKey | SOUPGWGAPDMYFM-BPPAMHLBSA-N |
| XLogP | 2.37 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |