C22H28N2O — CID 69210439
(2S)-1,4-dibenzyl-2-(3-methoxyprop-2-enyl)piperazine (PubChem CID 69210439) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is (2S)-1,4-dibenzyl-2-(3-methoxyprop-2-enyl)piperazine.
| Compound Name | (2S)-1,4-dibenzyl-2-(3-methoxyprop-2-enyl)piperazine |
|---|---|
| PubChem CID | 69210439 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (2S)-1,4-dibenzyl-2-(3-methoxyprop-2-enyl)piperazine |
| SMILES | COC=CC[C@H]1CN(Cc2ccccc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O/c1-25-16-8-13-22-19-23(17-20-9-4-2-5-10-20)14-15-24(22)18-21-11-6-3-7-12-21/h2-12,16,22H,13-15,17-19H2,1H3/t22-/m0/s1 |
| InChIKey | ZQVGHMHTEYVJEA-QFIPXVFZSA-N |
| XLogP | 3.92 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|