C19H22N2O — CID 124566770
(2R)-1,4-dibenzylpiperazine-2-carbaldehyde (PubChem CID 124566770) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (2R)-1,4-dibenzylpiperazine-2-carbaldehyde.
| Compound Name | (2R)-1,4-dibenzylpiperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 124566770 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2R)-1,4-dibenzylpiperazine-2-carbaldehyde |
| SMILES | O=C[C@H]1CN(Cc2ccccc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c22-16-19-15-20(13-17-7-3-1-4-8-17)11-12-21(19)14-18-9-5-2-6-10-18/h1-10,16,19H,11-15H2/t19-/m1/s1 |
| InChIKey | GPGHMUYOZRAMNQ-LJQANCHMSA-N |
| XLogP | 2.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|