About 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile
2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile (PubChem CID 167966270) has the molecular formula C20H22N2O2
and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile |
| PubChem CID | 167966270 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile |
| SMILES | CO[C@@H]1C[C@@H](CO)N(Cc2ccc(-c3ccccc3C#N)cc2)C1 |
| InChI | InChI=1S/C20H22N2O2/c1-24-19-10-18(14-23)22(13-19)12-15-6-8-16(9-7-15)20-5-3-2-4-17(20)11-21/h2-9,18-19,23H,10,12-14H2,1H3/t18-,19+/m0/s1 |
| InChIKey | VWUBUHDQUKGSMP-RBUKOAKNSA-N |
| XLogP | 2.81 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile?
The IUPAC name of 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile (CID 167966270) is 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile.
What is the SMILES notation for 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile?
The canonical SMILES for 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile is CO[C@@H]1C[C@@H](CO)N(Cc2ccc(-c3ccccc3C#N)cc2)C1.
What is the InChIKey of 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile?
The InChIKey is VWUBUHDQUKGSMP-RBUKOAKNSA-N. The full InChI is InChI=1S/C20H22N2O2/c1-24-19-10-18(14-23)22(13-19)12-15-6-8-16(9-7-15)20-5-3-2-4-17(20)11-21/h2-9,18-19,23H,10,12-14H2,1H3/t18-,19+/m0/s1.
What are the key properties of 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile?
2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile has a molecular weight of 322.41 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methyl]phenyl]benzonitrile is sourced from PubChem (CID 167966270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).