About [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol
[(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol (PubChem CID 128979786) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol |
| PubChem CID | 128979786 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol |
| SMILES | CO[C@@H]1C[C@@H](CO)N(Cc2ccc3cn[nH]c3c2)C1 |
| InChI | InChI=1S/C14H19N3O2/c1-19-13-5-12(9-18)17(8-13)7-10-2-3-11-6-15-16-14(11)4-10/h2-4,6,12-13,18H,5,7-9H2,1H3,(H,15,16)/t12-,13+/m0/s1 |
| InChIKey | KKDDJAIQSUYGBK-QWHCGFSZSA-N |
| XLogP | 1.14 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol?
The IUPAC name of [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol (CID 128979786) is [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol?
The canonical SMILES for [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol is CO[C@@H]1C[C@@H](CO)N(Cc2ccc3cn[nH]c3c2)C1.
What is the InChIKey of [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol?
The InChIKey is KKDDJAIQSUYGBK-QWHCGFSZSA-N. The full InChI is InChI=1S/C14H19N3O2/c1-19-13-5-12(9-18)17(8-13)7-10-2-3-11-6-15-16-14(11)4-10/h2-4,6,12-13,18H,5,7-9H2,1H3,(H,15,16)/t12-,13+/m0/s1.
What are the key properties of [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol?
[(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol has a molecular weight of 261.32 g/mol, XLogP of 1.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R)-1-(1H-indazol-6-ylmethyl)-4-methoxypyrrolidin-2-yl]methanol is sourced from PubChem (CID 128979786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).