C18H21NO3S — CID 101250953
[(2S,3R)-1-benzyl-3-phenylazetidin-2-yl]methyl methanesulfonate (PubChem CID 101250953) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is [(2S,3R)-1-benzyl-3-phenylazetidin-2-yl]methyl methanesulfonate.
| Compound Name | [(2S,3R)-1-benzyl-3-phenylazetidin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 101250953 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [(2S,3R)-1-benzyl-3-phenylazetidin-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1[C@H](c2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C18H21NO3S/c1-23(20,21)22-14-18-17(16-10-6-3-7-11-16)13-19(18)12-15-8-4-2-5-9-15/h2-11,17-18H,12-14H2,1H3/t17-,18+/m0/s1 |
| InChIKey | WQKNZRDYLNCYFH-ZWKOTPCHSA-N |
| XLogP | 2.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|