About (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine
(1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine (PubChem CID 101385103) has the molecular formula C20H26N2
and a molecular weight of 294.44 g/mol. Its IUPAC name is (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine |
| PubChem CID | 101385103 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine |
| SMILES | CC(C)[C@H](N)[C@H]1[C@H](c2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C20H26N2/c1-15(2)19(21)20-18(17-11-7-4-8-12-17)14-22(20)13-16-9-5-3-6-10-16/h3-12,15,18-20H,13-14,21H2,1-2H3/t18-,19-,20+/m0/s1 |
| InChIKey | BNVAJLGBONMPOP-SLFFLAALSA-N |
| XLogP | 3.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine?
The IUPAC name of (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine (CID 101385103) is (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine.
What is the SMILES notation for (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine?
The canonical SMILES for (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine is CC(C)[C@H](N)[C@H]1[C@H](c2ccccc2)CN1Cc1ccccc1.
What is the InChIKey of (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine?
The InChIKey is BNVAJLGBONMPOP-SLFFLAALSA-N. The full InChI is InChI=1S/C20H26N2/c1-15(2)19(21)20-18(17-11-7-4-8-12-17)14-22(20)13-16-9-5-3-6-10-16/h3-12,15,18-20H,13-14,21H2,1-2H3/t18-,19-,20+/m0/s1.
What are the key properties of (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine?
(1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine has a molecular weight of 294.44 g/mol, XLogP of 3.64, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine is sourced from PubChem (CID 101385103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).