C20H26N2 — CID 101385103
(1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine (PubChem CID 101385103) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine.
| Compound Name | (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 101385103 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (1S)-1-[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-2-methylpropan-1-amine |
| SMILES | CC(C)[C@H](N)[C@H]1[C@H](c2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C20H26N2/c1-15(2)19(21)20-18(17-11-7-4-8-12-17)14-22(20)13-16-9-5-3-6-10-16/h3-12,15,18-20H,13-14,21H2,1-2H3/t18-,19-,20+/m0/s1 |
| InChIKey | BNVAJLGBONMPOP-SLFFLAALSA-N |
| XLogP | 3.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |