C19H24N2 — CID 101367368
(1S)-1-[(2R,3R,4S)-1-benzyl-4-methyl-3-phenylazetidin-2-yl]ethanamine (PubChem CID 101367368) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is (1S)-1-[(2R,3R,4S)-1-benzyl-4-methyl-3-phenylazetidin-2-yl]ethanamine.
| Compound Name | (1S)-1-[(2R,3R,4S)-1-benzyl-4-methyl-3-phenylazetidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 101367368 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (1S)-1-[(2R,3R,4S)-1-benzyl-4-methyl-3-phenylazetidin-2-yl]ethanamine |
| SMILES | C[C@H](N)[C@H]1[C@H](c2ccccc2)[C@H](C)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2/c1-14(20)19-18(17-11-7-4-8-12-17)15(2)21(19)13-16-9-5-3-6-10-16/h3-12,14-15,18-19H,13,20H2,1-2H3/t14-,15-,18-,19-/m0/s1 |
| InChIKey | TVGBTSXTOBKMGO-LNMJFAINSA-N |
| XLogP | 3.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |