C15H24N2 — CID 124710393
(2R,3S,4R,6S)-1-benzyl-2,4,6-trimethylpiperidin-3-amine (PubChem CID 124710393) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is (2R,3S,4R,6S)-1-benzyl-2,4,6-trimethylpiperidin-3-amine.
| Compound Name | (2R,3S,4R,6S)-1-benzyl-2,4,6-trimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 124710393 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (2R,3S,4R,6S)-1-benzyl-2,4,6-trimethylpiperidin-3-amine |
| SMILES | C[C@@H]1C[C@H](C)N(Cc2ccccc2)[C@H](C)[C@H]1N |
| InChI | InChI=1S/C15H24N2/c1-11-9-12(2)17(13(3)15(11)16)10-14-7-5-4-6-8-14/h4-8,11-13,15H,9-10,16H2,1-3H3/t11-,12+,13-,15+/m1/s1 |
| InChIKey | VLNSZQNRDVTFLY-COMQUAJESA-N |
| XLogP | 2.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |