C15H23NOS — CID 130863871
1-benzyl-2,6-dimethyl-4-(sulfanylmethyl)piperidin-3-ol (PubChem CID 130863871) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is 1-benzyl-2,6-dimethyl-4-(sulfanylmethyl)piperidin-3-ol.
| Compound Name | 1-benzyl-2,6-dimethyl-4-(sulfanylmethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 130863871 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-benzyl-2,6-dimethyl-4-(sulfanylmethyl)piperidin-3-ol |
| SMILES | CC1CC(CS)C(O)C(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C15H23NOS/c1-11-8-14(10-18)15(17)12(2)16(11)9-13-6-4-3-5-7-13/h3-7,11-12,14-15,17-18H,8-10H2,1-2H3 |
| InChIKey | QSABGDFHMRQSNC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|