C22H26N2 — CID 56865189
(2R,3S,6R)-5-benzyl-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecane (PubChem CID 56865189) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (2R,3S,6R)-5-benzyl-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecane.
| Compound Name | (2R,3S,6R)-5-benzyl-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecane |
|---|---|
| PubChem CID | 56865189 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (2R,3S,6R)-5-benzyl-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecane |
| SMILES | c1ccc(CN2C[C@H](c3ccccc3)[C@@H]3[C@H]2C2CCN3CC2)cc1 |
| InChI | InChI=1S/C22H26N2/c1-3-7-17(8-4-1)15-24-16-20(18-9-5-2-6-10-18)22-21(24)19-11-13-23(22)14-12-19/h1-10,19-22H,11-16H2/t20-,21-,22-/m1/s1 |
| InChIKey | NMQMMKATORBIQD-YPAWHYETSA-N |
| XLogP | 3.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |