C24H28N4 — CID 56903207
(2R,3S,6R)-5-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecane (PubChem CID 56903207) has the molecular formula C24H28N4 and a molecular weight of 372.52 g/mol. Its IUPAC name is (2R,3S,6R)-5-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecane.
| Compound Name | (2R,3S,6R)-5-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecane |
|---|---|
| PubChem CID | 56903207 |
| Molecular Formula | C24H28N4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (2R,3S,6R)-5-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]-3-phenyl-1,5-diazatricyclo[5.2.2.02,6]undecane |
| SMILES | Cc1ccn2cc(CN3C[C@H](c4ccccc4)[C@@H]4[C@H]3C3CCN4CC3)nc2c1 |
| InChI | InChI=1S/C24H28N4/c1-17-7-10-27-14-20(25-22(27)13-17)15-28-16-21(18-5-3-2-4-6-18)24-23(28)19-8-11-26(24)12-9-19/h2-7,10,13-14,19,21,23-24H,8-9,11-12,15-16H2,1H3/t21-,23-,24-/m1/s1 |
| InChIKey | DRCQWKYCULTKSE-GMKZXUHWSA-N |
| XLogP | 3.70 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |