C30H34N2O — CID 10343107
(2S,3S,4S,7S)-6-[(2-methoxyphenyl)methyl]-3,4-diphenyl-1,6-diazatricyclo[6.2.2.02,7]dodecane (PubChem CID 10343107) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is (2S,3S,4S,7S)-6-[(2-methoxyphenyl)methyl]-3,4-diphenyl-1,6-diazatricyclo[6.2.2.02,7]dodecane.
| Compound Name | (2S,3S,4S,7S)-6-[(2-methoxyphenyl)methyl]-3,4-diphenyl-1,6-diazatricyclo[6.2.2.02,7]dodecane |
|---|---|
| PubChem CID | 10343107 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | (2S,3S,4S,7S)-6-[(2-methoxyphenyl)methyl]-3,4-diphenyl-1,6-diazatricyclo[6.2.2.02,7]dodecane |
| SMILES | COc1ccccc1CN1C[C@H](c2ccccc2)[C@@H](c2ccccc2)[C@H]2[C@@H]1C1CCN2CC1 |
| InChI | InChI=1S/C30H34N2O/c1-33-27-15-9-8-14-25(27)20-32-21-26(22-10-4-2-5-11-22)28(23-12-6-3-7-13-23)30-29(32)24-16-18-31(30)19-17-24/h2-15,24,26,28-30H,16-21H2,1H3/t26-,28-,29+,30+/m1/s1 |
| InChIKey | LHUPPESNNUHZBQ-OKCNIUFZSA-N |
| XLogP | 5.54 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |