C19H21NO — CID 101349406
(E)-3-[(2S,3R)-1-benzyl-3-phenylazetidin-2-yl]prop-2-en-1-ol (PubChem CID 101349406) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (E)-3-[(2S,3R)-1-benzyl-3-phenylazetidin-2-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(2S,3R)-1-benzyl-3-phenylazetidin-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 101349406 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (E)-3-[(2S,3R)-1-benzyl-3-phenylazetidin-2-yl]prop-2-en-1-ol |
| SMILES | OC/C=C/[C@H]1[C@H](c2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C19H21NO/c21-13-7-12-19-18(17-10-5-2-6-11-17)15-20(19)14-16-8-3-1-4-9-16/h1-12,18-19,21H,13-15H2/b12-7+/t18-,19-/m0/s1 |
| InChIKey | OFKNPVBMHOHRJX-SZCOOPAMSA-N |
| XLogP | 3.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|