C23H22Cl2N2Pd — CID 11420719
[(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-phenylmethanimine;dichloropalladium (PubChem CID 11420719) has the molecular formula C23H22Cl2N2Pd and a molecular weight of 503.77 g/mol. Its IUPAC name is [(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-phenylmethanimine;dichloropalladium.
| Compound Name | [(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-phenylmethanimine;dichloropalladium |
|---|---|
| PubChem CID | 11420719 |
| Molecular Formula | C23H22Cl2N2Pd |
| Molecular Weight | 503.77 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | [(2R,3R)-1-benzyl-3-phenylazetidin-2-yl]-phenylmethanimine;dichloropalladium |
| SMILES | Cl[Pd]Cl.[H]/N=C(\c1ccccc1)[C@H]1[C@H](c2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C23H22N2.2ClH.Pd/c24-22(20-14-8-3-9-15-20)23-21(19-12-6-2-7-13-19)17-25(23)16-18-10-4-1-5-11-18;;;/h1-15,21,23-24H,16-17H2;2*1H;/q;;;+2/p-2/b24-22+;;;/t21-,23+;;;/m0.../s1 |
| InChIKey | FYRBNEDKBHPDAA-VMWRRZOVSA-L |
| XLogP | 6.10 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.77 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|